C24H24F2O4 — CID 57096005
(4S,6R)-6-[3-[bis(4-fluorophenyl)methylidene]-4-methylpent-1-enyl]-4,6-dihydroxyoxan-2-one (PubChem CID 57096005) has the molecular formula C24H24F2O4 and a molecular weight of 414.45 g/mol. Its IUPAC name is (4S,6R)-6-[3-[bis(4-fluorophenyl)methylidene]-4-methylpent-1-enyl]-4,6-dihydroxyoxan-2-one.
| Compound Name | (4S,6R)-6-[3-[bis(4-fluorophenyl)methylidene]-4-methylpent-1-enyl]-4,6-dihydroxyoxan-2-one |
|---|---|
| PubChem CID | 57096005 |
| Molecular Formula | C24H24F2O4 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | (4S,6R)-6-[3-[bis(4-fluorophenyl)methylidene]-4-methylpent-1-enyl]-4,6-dihydroxyoxan-2-one |
| SMILES | CC(C)C(C=C[C@@]1(O)C[C@H](O)CC(=O)O1)=C(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H24F2O4/c1-15(2)21(11-12-24(29)14-20(27)13-22(28)30-24)23(16-3-7-18(25)8-4-16)17-5-9-19(26)10-6-17/h3-12,15,20,27,29H,13-14H2,1-2H3/t20-,24+/m1/s1 |
| InChIKey | VBJJEPOIWXRWBM-YKSBVNFPSA-N |
| XLogP | 4.37 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|