C16H18F3NO3 — CID 57096324
methyl 2-(1-methylcyclopentyl)oxyimino-2-[4-(trifluoromethyl)phenyl]acetate (PubChem CID 57096324) has the molecular formula C16H18F3NO3 and a molecular weight of 329.32 g/mol. Its IUPAC name is methyl 2-(1-methylcyclopentyl)oxyimino-2-[4-(trifluoromethyl)phenyl]acetate.
| Compound Name | methyl 2-(1-methylcyclopentyl)oxyimino-2-[4-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 57096324 |
| Molecular Formula | C16H18F3NO3 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | methyl 2-(1-methylcyclopentyl)oxyimino-2-[4-(trifluoromethyl)phenyl]acetate |
| SMILES | COC(=O)C(=NOC1(C)CCCC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H18F3NO3/c1-15(9-3-4-10-15)23-20-13(14(21)22-2)11-5-7-12(8-6-11)16(17,18)19/h5-8H,3-4,9-10H2,1-2H3 |
| InChIKey | WVSJQCSDNNYCIW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|