About 1-(2-chlorophenyl)-1-(5-ethyl-2-phenyl-1,2,4-triazol-3-yl)urea
1-(2-chlorophenyl)-1-(5-ethyl-2-phenyl-1,2,4-triazol-3-yl)urea (PubChem CID 57096424) has the molecular formula C17H16ClN5O
and a molecular weight of 341.80 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-1-(5-ethyl-2-phenyl-1,2,4-triazol-3-yl)urea.
Molecular Properties
| Compound Name | 1-(2-chlorophenyl)-1-(5-ethyl-2-phenyl-1,2,4-triazol-3-yl)urea |
| PubChem CID | 57096424 |
| Molecular Formula | C17H16ClN5O |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 1-(2-chlorophenyl)-1-(5-ethyl-2-phenyl-1,2,4-triazol-3-yl)urea |
| SMILES | CCc1nc(N(C(N)=O)c2ccccc2Cl)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C17H16ClN5O/c1-2-15-20-17(23(21-15)12-8-4-3-5-9-12)22(16(19)24)14-11-7-6-10-13(14)18/h3-11H,2H2,1H3,(H2,19,24) |
| InChIKey | AFSUVYBXTCJOKF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-chlorophenyl)-1-(5-ethyl-2-phenyl-1,2,4-triazol-3-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chlorophenyl)-1-(5-ethyl-2-phenyl-1,2,4-triazol-3-yl)urea?
The IUPAC name of 1-(2-chlorophenyl)-1-(5-ethyl-2-phenyl-1,2,4-triazol-3-yl)urea (CID 57096424) is 1-(2-chlorophenyl)-1-(5-ethyl-2-phenyl-1,2,4-triazol-3-yl)urea.
What is the SMILES notation for 1-(2-chlorophenyl)-1-(5-ethyl-2-phenyl-1,2,4-triazol-3-yl)urea?
The canonical SMILES for 1-(2-chlorophenyl)-1-(5-ethyl-2-phenyl-1,2,4-triazol-3-yl)urea is CCc1nc(N(C(N)=O)c2ccccc2Cl)n(-c2ccccc2)n1.
What is the InChIKey of 1-(2-chlorophenyl)-1-(5-ethyl-2-phenyl-1,2,4-triazol-3-yl)urea?
The InChIKey is AFSUVYBXTCJOKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16ClN5O/c1-2-15-20-17(23(21-15)12-8-4-3-5-9-12)22(16(19)24)14-11-7-6-10-13(14)18/h3-11H,2H2,1H3,(H2,19,24).
What are the key properties of 1-(2-chlorophenyl)-1-(5-ethyl-2-phenyl-1,2,4-triazol-3-yl)urea?
1-(2-chlorophenyl)-1-(5-ethyl-2-phenyl-1,2,4-triazol-3-yl)urea has a molecular weight of 341.80 g/mol, XLogP of 3.70, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chlorophenyl)-1-(5-ethyl-2-phenyl-1,2,4-triazol-3-yl)urea is sourced from PubChem (CID 57096424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).