C17H19F3O2 — CID 57096585
2-ethoxy-1,1,1-trifluoro-5-naphthalen-2-ylpentan-2-ol (PubChem CID 57096585) has the molecular formula C17H19F3O2 and a molecular weight of 312.33 g/mol. Its IUPAC name is 2-ethoxy-1,1,1-trifluoro-5-naphthalen-2-ylpentan-2-ol.
| Compound Name | 2-ethoxy-1,1,1-trifluoro-5-naphthalen-2-ylpentan-2-ol |
|---|---|
| PubChem CID | 57096585 |
| Molecular Formula | C17H19F3O2 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 2-ethoxy-1,1,1-trifluoro-5-naphthalen-2-ylpentan-2-ol |
| SMILES | CCOC(O)(CCCc1ccc2ccccc2c1)C(F)(F)F |
| InChI | InChI=1S/C17H19F3O2/c1-2-22-16(21,17(18,19)20)11-5-6-13-9-10-14-7-3-4-8-15(14)12-13/h3-4,7-10,12,21H,2,5-6,11H2,1H3 |
| InChIKey | RJLKFHUKJYNVBN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|