C12H17ClF2N8S2 — CID 57096746
1-[2-[[2-[[N'-(2-chloro-2,2-difluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-cyano-1-methylguanidine (PubChem CID 57096746) has the molecular formula C12H17ClF2N8S2 and a molecular weight of 410.91 g/mol. Its IUPAC name is 1-[2-[[2-[[N'-(2-chloro-2,2-difluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-cyano-1-methylguanidine.
| Compound Name | 1-[2-[[2-[[N'-(2-chloro-2,2-difluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-cyano-1-methylguanidine |
|---|---|
| PubChem CID | 57096746 |
| Molecular Formula | C12H17ClF2N8S2 |
| Molecular Weight | 410.91 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 1-[2-[[2-[[N'-(2-chloro-2,2-difluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-cyano-1-methylguanidine |
| SMILES | CN(CCSCc1csc(N/C(N)=N/CC(F)(F)Cl)n1)/C(N)=N/C#N |
| InChI | InChI=1S/C12H17ClF2N8S2/c1-23(10(18)20-7-16)2-3-24-4-8-5-25-11(21-8)22-9(17)19-6-12(13,14)15/h5H,2-4,6H2,1H3,(H2,18,20)(H3,17,19,21,22) |
| InChIKey | MHIMFQDMMSMZLT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 128.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.91 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|