C15H6Br2F3NO — CID 57096944
5,7-dibromo-3-[(2,4,6-trifluorophenyl)methylidene]-1H-indol-2-one (PubChem CID 57096944) has the molecular formula C15H6Br2F3NO and a molecular weight of 433.02 g/mol. Its IUPAC name is 5,7-dibromo-3-[(2,4,6-trifluorophenyl)methylidene]-1H-indol-2-one.
| Compound Name | 5,7-dibromo-3-[(2,4,6-trifluorophenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 57096944 |
| Molecular Formula | C15H6Br2F3NO |
| Molecular Weight | 433.02 g/mol |
| Exact Mass | 430.88 |
| IUPAC Name | 5,7-dibromo-3-[(2,4,6-trifluorophenyl)methylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2c(Br)cc(Br)cc2C1=Cc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C15H6Br2F3NO/c16-6-1-8-9(15(22)21-14(8)11(17)2-6)5-10-12(19)3-7(18)4-13(10)20/h1-5H,(H,21,22) |
| InChIKey | UBODIRSIBCREMI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.02 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|