C23H26N2O3 — CID 57097106
2-[2-[(5-butyl-2-oxo-1H-indol-3-ylidene)methyl]-4,5,6,7-tetrahydro-1H-indol-4-yl]acetic acid (PubChem CID 57097106) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is 2-[2-[(5-butyl-2-oxo-1H-indol-3-ylidene)methyl]-4,5,6,7-tetrahydro-1H-indol-4-yl]acetic acid.
| Compound Name | 2-[2-[(5-butyl-2-oxo-1H-indol-3-ylidene)methyl]-4,5,6,7-tetrahydro-1H-indol-4-yl]acetic acid |
|---|---|
| PubChem CID | 57097106 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 2-[2-[(5-butyl-2-oxo-1H-indol-3-ylidene)methyl]-4,5,6,7-tetrahydro-1H-indol-4-yl]acetic acid |
| SMILES | CCCCc1ccc2c(c1)C(=Cc1cc3c([nH]1)CCCC3CC(=O)O)C(=O)N2 |
| InChI | InChI=1S/C23H26N2O3/c1-2-3-5-14-8-9-21-18(10-14)19(23(28)25-21)13-16-12-17-15(11-22(26)27)6-4-7-20(17)24-16/h8-10,12-13,15,24H,2-7,11H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | HULZOJFHYSBJFB-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|