C19H36OSi — CID 57097575
[(1S,3aS,4R,7aS)-7a-methyl-1-prop-1-en-2-yl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 57097575) has the molecular formula C19H36OSi and a molecular weight of 308.58 g/mol. Its IUPAC name is [(1S,3aS,4R,7aS)-7a-methyl-1-prop-1-en-2-yl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,3aS,4R,7aS)-7a-methyl-1-prop-1-en-2-yl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 57097575 |
| Molecular Formula | C19H36OSi |
| Molecular Weight | 308.58 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | [(1S,3aS,4R,7aS)-7a-methyl-1-prop-1-en-2-yl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=C(C)[C@@H]1CC[C@@H]2[C@H](O[Si](C)(C)C(C)(C)C)CCC[C@]21C |
| InChI | InChI=1S/C19H36OSi/c1-14(2)15-11-12-16-17(10-9-13-19(15,16)6)20-21(7,8)18(3,4)5/h15-17H,1,9-13H2,2-8H3/t15-,16+,17+,19-/m0/s1 |
| InChIKey | QYSMTSGDQWEEIF-FAJBIJEISA-N |
| XLogP | 6.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.58 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|