C17H30 — CID 57097871
(5-ethynyl-2,7-dimethylnonan-5-yl)cyclobutane (PubChem CID 57097871) has the molecular formula C17H30 and a molecular weight of 234.43 g/mol. Its IUPAC name is (5-ethynyl-2,7-dimethylnonan-5-yl)cyclobutane.
| Compound Name | (5-ethynyl-2,7-dimethylnonan-5-yl)cyclobutane |
|---|---|
| PubChem CID | 57097871 |
| Molecular Formula | C17H30 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | (5-ethynyl-2,7-dimethylnonan-5-yl)cyclobutane |
| SMILES | C#CC(CCC(C)C)(CC(C)CC)C1CCC1 |
| InChI | InChI=1S/C17H30/c1-6-15(5)13-17(7-2,12-11-14(3)4)16-9-8-10-16/h2,14-16H,6,8-13H2,1,3-5H3 |
| InChIKey | RVOIRYWBVBLUSI-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|