C13H12N2O2S — CID 57098102
4-[(3-methoxynaphthalen-2-yl)methyl]-3H-1,2,3,5-oxathiadiazole (PubChem CID 57098102) has the molecular formula C13H12N2O2S and a molecular weight of 260.32 g/mol. Its IUPAC name is 4-[(3-methoxynaphthalen-2-yl)methyl]-3H-1,2,3,5-oxathiadiazole.
| Compound Name | 4-[(3-methoxynaphthalen-2-yl)methyl]-3H-1,2,3,5-oxathiadiazole |
|---|---|
| PubChem CID | 57098102 |
| Molecular Formula | C13H12N2O2S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 4-[(3-methoxynaphthalen-2-yl)methyl]-3H-1,2,3,5-oxathiadiazole |
| SMILES | COc1cc2ccccc2cc1CC1=NOSN1 |
| InChI | InChI=1S/C13H12N2O2S/c1-16-12-7-10-5-3-2-4-9(10)6-11(12)8-13-14-17-18-15-13/h2-7H,8H2,1H3,(H,14,15) |
| InChIKey | UFMHQXBINKWCTL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|