About 2-(1,5-naphthyridin-4-ylamino)-N,N-dipropylpropanamide
2-(1,5-naphthyridin-4-ylamino)-N,N-dipropylpropanamide (PubChem CID 57098225) has the molecular formula C17H24N4O
and a molecular weight of 300.41 g/mol. Its IUPAC name is 2-(1,5-naphthyridin-4-ylamino)-N,N-dipropylpropanamide.
Molecular Properties
| Compound Name | 2-(1,5-naphthyridin-4-ylamino)-N,N-dipropylpropanamide |
| PubChem CID | 57098225 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 2-(1,5-naphthyridin-4-ylamino)-N,N-dipropylpropanamide |
| SMILES | CCCN(CCC)C(=O)C(C)Nc1ccnc2cccnc12 |
| InChI | InChI=1S/C17H24N4O/c1-4-11-21(12-5-2)17(22)13(3)20-15-8-10-18-14-7-6-9-19-16(14)15/h6-10,13H,4-5,11-12H2,1-3H3,(H,18,20) |
| InChIKey | GTICSVPBSFGDTJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,5-naphthyridin-4-ylamino)-N,N-dipropylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,5-naphthyridin-4-ylamino)-N,N-dipropylpropanamide?
The IUPAC name of 2-(1,5-naphthyridin-4-ylamino)-N,N-dipropylpropanamide (CID 57098225) is 2-(1,5-naphthyridin-4-ylamino)-N,N-dipropylpropanamide.
What is the SMILES notation for 2-(1,5-naphthyridin-4-ylamino)-N,N-dipropylpropanamide?
The canonical SMILES for 2-(1,5-naphthyridin-4-ylamino)-N,N-dipropylpropanamide is CCCN(CCC)C(=O)C(C)Nc1ccnc2cccnc12.
What is the InChIKey of 2-(1,5-naphthyridin-4-ylamino)-N,N-dipropylpropanamide?
The InChIKey is GTICSVPBSFGDTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N4O/c1-4-11-21(12-5-2)17(22)13(3)20-15-8-10-18-14-7-6-9-19-16(14)15/h6-10,13H,4-5,11-12H2,1-3H3,(H,18,20).
What are the key properties of 2-(1,5-naphthyridin-4-ylamino)-N,N-dipropylpropanamide?
2-(1,5-naphthyridin-4-ylamino)-N,N-dipropylpropanamide has a molecular weight of 300.41 g/mol, XLogP of 3.08, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,5-naphthyridin-4-ylamino)-N,N-dipropylpropanamide is sourced from PubChem (CID 57098225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).