C20H26N2O6 — CID 57098465
2-[[3-[(2,6-dihydroxy-3-methoxyphenyl)methyl]-1,3-diazinan-1-yl]methyl]-4-methoxybenzene-1,3-diol (PubChem CID 57098465) has the molecular formula C20H26N2O6 and a molecular weight of 390.44 g/mol. Its IUPAC name is 2-[[3-[(2,6-dihydroxy-3-methoxyphenyl)methyl]-1,3-diazinan-1-yl]methyl]-4-methoxybenzene-1,3-diol.
| Compound Name | 2-[[3-[(2,6-dihydroxy-3-methoxyphenyl)methyl]-1,3-diazinan-1-yl]methyl]-4-methoxybenzene-1,3-diol |
|---|---|
| PubChem CID | 57098465 |
| Molecular Formula | C20H26N2O6 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 2-[[3-[(2,6-dihydroxy-3-methoxyphenyl)methyl]-1,3-diazinan-1-yl]methyl]-4-methoxybenzene-1,3-diol |
| SMILES | COc1ccc(O)c(CN2CCCN(Cc3c(O)ccc(OC)c3O)C2)c1O |
| InChI | InChI=1S/C20H26N2O6/c1-27-17-6-4-15(23)13(19(17)25)10-21-8-3-9-22(12-21)11-14-16(24)5-7-18(28-2)20(14)26/h4-7,23-26H,3,8-12H2,1-2H3 |
| InChIKey | YWBUHJZHOGWCGW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 105.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|