About [(2S,3R)-2-(3-amino-3-oxoprop-1-enyl)-4-oxoazetidin-3-yl]-tert-butylcarbamic acid
[(2S,3R)-2-(3-amino-3-oxoprop-1-enyl)-4-oxoazetidin-3-yl]-tert-butylcarbamic acid (PubChem CID 57098682) has the molecular formula C11H17N3O4
and a molecular weight of 255.27 g/mol. Its IUPAC name is [(2S,3R)-2-(3-amino-3-oxoprop-1-enyl)-4-oxoazetidin-3-yl]-tert-butylcarbamic acid.
Molecular Properties
| Compound Name | [(2S,3R)-2-(3-amino-3-oxoprop-1-enyl)-4-oxoazetidin-3-yl]-tert-butylcarbamic acid |
| PubChem CID | 57098682 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | [(2S,3R)-2-(3-amino-3-oxoprop-1-enyl)-4-oxoazetidin-3-yl]-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)[C@H]1C(=O)N[C@H]1C=CC(N)=O |
| InChI | InChI=1S/C11H17N3O4/c1-11(2,3)14(10(17)18)8-6(13-9(8)16)4-5-7(12)15/h4-6,8H,1-3H3,(H2,12,15)(H,13,16)(H,17,18)/t6-,8+/m0/s1 |
| InChIKey | IVBJPQGNMATHTM-POYBYMJQSA-N |
| XLogP | -0.33 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(2S,3R)-2-(3-amino-3-oxoprop-1-enyl)-4-oxoazetidin-3-yl]-tert-butylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3R)-2-(3-amino-3-oxoprop-1-enyl)-4-oxoazetidin-3-yl]-tert-butylcarbamic acid?
The IUPAC name of [(2S,3R)-2-(3-amino-3-oxoprop-1-enyl)-4-oxoazetidin-3-yl]-tert-butylcarbamic acid (CID 57098682) is [(2S,3R)-2-(3-amino-3-oxoprop-1-enyl)-4-oxoazetidin-3-yl]-tert-butylcarbamic acid.
What is the SMILES notation for [(2S,3R)-2-(3-amino-3-oxoprop-1-enyl)-4-oxoazetidin-3-yl]-tert-butylcarbamic acid?
The canonical SMILES for [(2S,3R)-2-(3-amino-3-oxoprop-1-enyl)-4-oxoazetidin-3-yl]-tert-butylcarbamic acid is CC(C)(C)N(C(=O)O)[C@H]1C(=O)N[C@H]1C=CC(N)=O.
What is the InChIKey of [(2S,3R)-2-(3-amino-3-oxoprop-1-enyl)-4-oxoazetidin-3-yl]-tert-butylcarbamic acid?
The InChIKey is IVBJPQGNMATHTM-POYBYMJQSA-N. The full InChI is InChI=1S/C11H17N3O4/c1-11(2,3)14(10(17)18)8-6(13-9(8)16)4-5-7(12)15/h4-6,8H,1-3H3,(H2,12,15)(H,13,16)(H,17,18)/t6-,8+/m0/s1.
What are the key properties of [(2S,3R)-2-(3-amino-3-oxoprop-1-enyl)-4-oxoazetidin-3-yl]-tert-butylcarbamic acid?
[(2S,3R)-2-(3-amino-3-oxoprop-1-enyl)-4-oxoazetidin-3-yl]-tert-butylcarbamic acid has a molecular weight of 255.27 g/mol, XLogP of -0.33, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3R)-2-(3-amino-3-oxoprop-1-enyl)-4-oxoazetidin-3-yl]-tert-butylcarbamic acid is sourced from PubChem (CID 57098682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).