About 2-methyl-3,4-dihydro-2H-thiopyrano[3,2-b]quinolin-10-amine
2-methyl-3,4-dihydro-2H-thiopyrano[3,2-b]quinolin-10-amine (PubChem CID 57098793) has the molecular formula C13H14N2S
and a molecular weight of 230.34 g/mol. Its IUPAC name is 2-methyl-3,4-dihydro-2H-thiopyrano[3,2-b]quinolin-10-amine.
Molecular Properties
| Compound Name | 2-methyl-3,4-dihydro-2H-thiopyrano[3,2-b]quinolin-10-amine |
| PubChem CID | 57098793 |
| Molecular Formula | C13H14N2S |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 2-methyl-3,4-dihydro-2H-thiopyrano[3,2-b]quinolin-10-amine |
| SMILES | CC1CCc2nc3ccccc3c(N)c2S1 |
| InChI | InChI=1S/C13H14N2S/c1-8-6-7-11-13(16-8)12(14)9-4-2-3-5-10(9)15-11/h2-5,8H,6-7H2,1H3,(H2,14,15) |
| InChIKey | ADXWXJQHPOMIRN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-3,4-dihydro-2H-thiopyrano[3,2-b]quinolin-10-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3,4-dihydro-2H-thiopyrano[3,2-b]quinolin-10-amine?
The IUPAC name of 2-methyl-3,4-dihydro-2H-thiopyrano[3,2-b]quinolin-10-amine (CID 57098793) is 2-methyl-3,4-dihydro-2H-thiopyrano[3,2-b]quinolin-10-amine.
What is the SMILES notation for 2-methyl-3,4-dihydro-2H-thiopyrano[3,2-b]quinolin-10-amine?
The canonical SMILES for 2-methyl-3,4-dihydro-2H-thiopyrano[3,2-b]quinolin-10-amine is CC1CCc2nc3ccccc3c(N)c2S1.
What is the InChIKey of 2-methyl-3,4-dihydro-2H-thiopyrano[3,2-b]quinolin-10-amine?
The InChIKey is ADXWXJQHPOMIRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2S/c1-8-6-7-11-13(16-8)12(14)9-4-2-3-5-10(9)15-11/h2-5,8H,6-7H2,1H3,(H2,14,15).
What are the key properties of 2-methyl-3,4-dihydro-2H-thiopyrano[3,2-b]quinolin-10-amine?
2-methyl-3,4-dihydro-2H-thiopyrano[3,2-b]quinolin-10-amine has a molecular weight of 230.34 g/mol, XLogP of 3.24, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3,4-dihydro-2H-thiopyrano[3,2-b]quinolin-10-amine is sourced from PubChem (CID 57098793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).