About 6-[dimethoxy(methyl)silyl]hex-1-ene-3,4-dione
6-[dimethoxy(methyl)silyl]hex-1-ene-3,4-dione (PubChem CID 57099022) has the molecular formula C9H16O4Si
and a molecular weight of 216.31 g/mol. Its IUPAC name is 6-[dimethoxy(methyl)silyl]hex-1-ene-3,4-dione.
Molecular Properties
| Compound Name | 6-[dimethoxy(methyl)silyl]hex-1-ene-3,4-dione |
| PubChem CID | 57099022 |
| Molecular Formula | C9H16O4Si |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 6-[dimethoxy(methyl)silyl]hex-1-ene-3,4-dione |
| SMILES | C=CC(=O)C(=O)CC[Si](C)(OC)OC |
| InChI | InChI=1S/C9H16O4Si/c1-5-8(10)9(11)6-7-14(4,12-2)13-3/h5H,1,6-7H2,2-4H3 |
| InChIKey | GRKBAZVCNCWCTE-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-[dimethoxy(methyl)silyl]hex-1-ene-3,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[dimethoxy(methyl)silyl]hex-1-ene-3,4-dione?
The IUPAC name of 6-[dimethoxy(methyl)silyl]hex-1-ene-3,4-dione (CID 57099022) is 6-[dimethoxy(methyl)silyl]hex-1-ene-3,4-dione.
What is the SMILES notation for 6-[dimethoxy(methyl)silyl]hex-1-ene-3,4-dione?
The canonical SMILES for 6-[dimethoxy(methyl)silyl]hex-1-ene-3,4-dione is C=CC(=O)C(=O)CC[Si](C)(OC)OC.
What is the InChIKey of 6-[dimethoxy(methyl)silyl]hex-1-ene-3,4-dione?
The InChIKey is GRKBAZVCNCWCTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4Si/c1-5-8(10)9(11)6-7-14(4,12-2)13-3/h5H,1,6-7H2,2-4H3.
What are the key properties of 6-[dimethoxy(methyl)silyl]hex-1-ene-3,4-dione?
6-[dimethoxy(methyl)silyl]hex-1-ene-3,4-dione has a molecular weight of 216.31 g/mol, XLogP of 1.07, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[dimethoxy(methyl)silyl]hex-1-ene-3,4-dione is sourced from PubChem (CID 57099022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).