About 2-[3-(4-cyanophenyl)-2,5-dihydro-1,2-oxazol-5-yl]acetic acid
2-[3-(4-cyanophenyl)-2,5-dihydro-1,2-oxazol-5-yl]acetic acid (PubChem CID 57099117) has the molecular formula C12H10N2O3
and a molecular weight of 230.22 g/mol. Its IUPAC name is 2-[3-(4-cyanophenyl)-2,5-dihydro-1,2-oxazol-5-yl]acetic acid.
Analyze 2-[3-(4-cyanophenyl)-2,5-dihydro-1,2-oxazol-5-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(4-cyanophenyl)-2,5-dihydro-1,2-oxazol-5-yl]acetic acid?
The IUPAC name of 2-[3-(4-cyanophenyl)-2,5-dihydro-1,2-oxazol-5-yl]acetic acid (CID 57099117) is 2-[3-(4-cyanophenyl)-2,5-dihydro-1,2-oxazol-5-yl]acetic acid.
What is the SMILES notation for 2-[3-(4-cyanophenyl)-2,5-dihydro-1,2-oxazol-5-yl]acetic acid?
The canonical SMILES for 2-[3-(4-cyanophenyl)-2,5-dihydro-1,2-oxazol-5-yl]acetic acid is N#Cc1ccc(C2=CC(CC(=O)O)ON2)cc1.
What is the InChIKey of 2-[3-(4-cyanophenyl)-2,5-dihydro-1,2-oxazol-5-yl]acetic acid?
The InChIKey is GPMAPGYJMUANKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O3/c13-7-8-1-3-9(4-2-8)11-5-10(17-14-11)6-12(15)16/h1-5,10,14H,6H2,(H,15,16).
What are the key properties of 2-[3-(4-cyanophenyl)-2,5-dihydro-1,2-oxazol-5-yl]acetic acid?
2-[3-(4-cyanophenyl)-2,5-dihydro-1,2-oxazol-5-yl]acetic acid has a molecular weight of 230.22 g/mol, XLogP of 1.28, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(4-cyanophenyl)-2,5-dihydro-1,2-oxazol-5-yl]acetic acid is sourced from PubChem (CID 57099117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).