C22H38N+ — CID 57099242
1-benzyl-1-(2,3-dimethylbutyl)-3,5,5-trimethylazepan-1-ium (PubChem CID 57099242) has the molecular formula C22H38N+ and a molecular weight of 316.55 g/mol. Its IUPAC name is 1-benzyl-1-(2,3-dimethylbutyl)-3,5,5-trimethylazepan-1-ium.
| Compound Name | 1-benzyl-1-(2,3-dimethylbutyl)-3,5,5-trimethylazepan-1-ium |
|---|---|
| PubChem CID | 57099242 |
| Molecular Formula | C22H38N+ |
| Molecular Weight | 316.55 g/mol |
| Exact Mass | 316.30 |
| IUPAC Name | 1-benzyl-1-(2,3-dimethylbutyl)-3,5,5-trimethylazepan-1-ium |
| SMILES | CC1CC(C)(C)CC[N+](Cc2ccccc2)(CC(C)C(C)C)C1 |
| InChI | InChI=1S/C22H38N/c1-18(2)20(4)16-23(17-21-10-8-7-9-11-21)13-12-22(5,6)14-19(3)15-23/h7-11,18-20H,12-17H2,1-6H3/q+1 |
| InChIKey | AJYKZZMDFHTGKT-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.55 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|