C12H16ClN3O4 — CID 57099263
N-(2-chloroethyl)-2-(3,3-dinitropropyl)-4-methylaniline (PubChem CID 57099263) has the molecular formula C12H16ClN3O4 and a molecular weight of 301.73 g/mol. Its IUPAC name is N-(2-chloroethyl)-2-(3,3-dinitropropyl)-4-methylaniline.
| Compound Name | N-(2-chloroethyl)-2-(3,3-dinitropropyl)-4-methylaniline |
|---|---|
| PubChem CID | 57099263 |
| Molecular Formula | C12H16ClN3O4 |
| Molecular Weight | 301.73 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | N-(2-chloroethyl)-2-(3,3-dinitropropyl)-4-methylaniline |
| SMILES | Cc1ccc(NCCCl)c(CCC([N+](=O)[O-])[N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H16ClN3O4/c1-9-2-4-11(14-7-6-13)10(8-9)3-5-12(15(17)18)16(19)20/h2,4,8,12,14H,3,5-7H2,1H3 |
| InChIKey | MNDHRRZNWLYJPY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.73 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|