C9H12N2 — CID 57099276
2,3,4,10-tetrahydropyrimido[1,2-a]azepine (PubChem CID 57099276) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 2,3,4,10-tetrahydropyrimido[1,2-a]azepine.
| Compound Name | 2,3,4,10-tetrahydropyrimido[1,2-a]azepine |
|---|---|
| PubChem CID | 57099276 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 2,3,4,10-tetrahydropyrimido[1,2-a]azepine |
| SMILES | C1=CCC2=NCCCN2C=C1 |
| InChI | InChI=1S/C9H12N2/c1-2-5-9-10-6-4-8-11(9)7-3-1/h1-3,7H,4-6,8H2 |
| InChIKey | JPQUHXHIGKTUFM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |