(5,6-diethyl-3-methoxypyrazin-2-yl)carbamic acid

C10H15N3O3 — CID 57099309

IUPAC(5,6-diethyl-3-methoxypyrazin-2-yl)carbamic acid
SMILESCCc1nc(NC(=O)O)c(OC)nc1CC
InChIInChI=1S/C10H15N3O3/c1-4-6-7(5-2)12-9(16-3)8(11-6)13-10(14)15/h4-5H2,1-3H3,(H,11,13)(H,14,15)
InChIKeyOINHBBMRLXOEES-UHFFFAOYSA-N
MW225.25 g/mol
LogP1.70
Rot. Bonds4

About (5,6-diethyl-3-methoxypyrazin-2-yl)carbamic acid

(5,6-diethyl-3-methoxypyrazin-2-yl)carbamic acid (PubChem CID 57099309) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is (5,6-diethyl-3-methoxypyrazin-2-yl)carbamic acid.

Molecular Properties

Compound Name(5,6-diethyl-3-methoxypyrazin-2-yl)carbamic acid
PubChem CID57099309
Molecular FormulaC10H15N3O3
Molecular Weight225.25 g/mol
Exact Mass225.11
IUPAC Name(5,6-diethyl-3-methoxypyrazin-2-yl)carbamic acid
SMILESCCc1nc(NC(=O)O)c(OC)nc1CC
InChIInChI=1S/C10H15N3O3/c1-4-6-7(5-2)12-9(16-3)8(11-6)13-10(14)15/h4-5H2,1-3H3,(H,11,13)(H,14,15)
InChIKeyOINHBBMRLXOEES-UHFFFAOYSA-N
XLogP1.70
TPSA84.34 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.25
LogP ≤ 51.70
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze (5,6-diethyl-3-methoxypyrazin-2-yl)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5,6-diethyl-3-methoxypyrazin-2-yl)carbamic acid?
The IUPAC name of (5,6-diethyl-3-methoxypyrazin-2-yl)carbamic acid (CID 57099309) is (5,6-diethyl-3-methoxypyrazin-2-yl)carbamic acid.
What is the SMILES notation for (5,6-diethyl-3-methoxypyrazin-2-yl)carbamic acid?
The canonical SMILES for (5,6-diethyl-3-methoxypyrazin-2-yl)carbamic acid is CCc1nc(NC(=O)O)c(OC)nc1CC.
What is the InChIKey of (5,6-diethyl-3-methoxypyrazin-2-yl)carbamic acid?
The InChIKey is OINHBBMRLXOEES-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O3/c1-4-6-7(5-2)12-9(16-3)8(11-6)13-10(14)15/h4-5H2,1-3H3,(H,11,13)(H,14,15).
What are the key properties of (5,6-diethyl-3-methoxypyrazin-2-yl)carbamic acid?
(5,6-diethyl-3-methoxypyrazin-2-yl)carbamic acid has a molecular weight of 225.25 g/mol, XLogP of 1.70, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5,6-diethyl-3-methoxypyrazin-2-yl)carbamic acid is sourced from PubChem (CID 57099309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).