C18H33O5P — CID 57099868
1-[(2,6-ditert-butyl-4-methylphenyl)-trihydroxy-λ5-phosphanyl]propane-1,3-diol (PubChem CID 57099868) has the molecular formula C18H33O5P and a molecular weight of 360.43 g/mol. Its IUPAC name is 1-[(2,6-ditert-butyl-4-methylphenyl)-trihydroxy-λ5-phosphanyl]propane-1,3-diol.
| Compound Name | 1-[(2,6-ditert-butyl-4-methylphenyl)-trihydroxy-λ5-phosphanyl]propane-1,3-diol |
|---|---|
| PubChem CID | 57099868 |
| Molecular Formula | C18H33O5P |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 1-[(2,6-ditert-butyl-4-methylphenyl)-trihydroxy-λ5-phosphanyl]propane-1,3-diol |
| SMILES | Cc1cc(C(C)(C)C)c(P(O)(O)(O)C(O)CCO)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H33O5P/c1-12-10-13(17(2,3)4)16(14(11-12)18(5,6)7)24(21,22,23)15(20)8-9-19/h10-11,15,19-23H,8-9H2,1-7H3 |
| InChIKey | BYDFSXLQRLLAIV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|