C20H29NO4Si — CID 57099887
(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(3R)-4-oxo-2,3-dihydrochromen-3-yl]azetidin-2-one (PubChem CID 57099887) has the molecular formula C20H29NO4Si and a molecular weight of 375.54 g/mol. Its IUPAC name is (3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(3R)-4-oxo-2,3-dihydrochromen-3-yl]azetidin-2-one.
| Compound Name | (3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(3R)-4-oxo-2,3-dihydrochromen-3-yl]azetidin-2-one |
|---|---|
| PubChem CID | 57099887 |
| Molecular Formula | C20H29NO4Si |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | (3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(3R)-4-oxo-2,3-dihydrochromen-3-yl]azetidin-2-one |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N[C@@H]1[C@@H]1COc2ccccc2C1=O |
| InChI | InChI=1S/C20H29NO4Si/c1-12(25-26(5,6)20(2,3)4)16-17(21-19(16)23)14-11-24-15-10-8-7-9-13(15)18(14)22/h7-10,12,14,16-17H,11H2,1-6H3,(H,21,23)/t12-,14+,16-,17-/m1/s1 |
| InChIKey | MLUCTGFHQWTLLP-JWZBEHFJSA-N |
| XLogP | 3.40 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|