About 3-prop-2-enoxy-5-(2,2,2-trichloroethyl)pyridine
3-prop-2-enoxy-5-(2,2,2-trichloroethyl)pyridine (PubChem CID 57099920) has the molecular formula C10H10Cl3NO
and a molecular weight of 266.56 g/mol. Its IUPAC name is 3-prop-2-enoxy-5-(2,2,2-trichloroethyl)pyridine.
Molecular Properties
| Compound Name | 3-prop-2-enoxy-5-(2,2,2-trichloroethyl)pyridine |
| PubChem CID | 57099920 |
| Molecular Formula | C10H10Cl3NO |
| Molecular Weight | 266.56 g/mol |
| Exact Mass | 264.98 |
| IUPAC Name | 3-prop-2-enoxy-5-(2,2,2-trichloroethyl)pyridine |
| SMILES | C=CCOc1cncc(CC(Cl)(Cl)Cl)c1 |
| InChI | InChI=1S/C10H10Cl3NO/c1-2-3-15-9-4-8(6-14-7-9)5-10(11,12)13/h2,4,6-7H,1,3,5H2 |
| InChIKey | ABVHZQGNCJGYBJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.56 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-prop-2-enoxy-5-(2,2,2-trichloroethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-prop-2-enoxy-5-(2,2,2-trichloroethyl)pyridine?
The IUPAC name of 3-prop-2-enoxy-5-(2,2,2-trichloroethyl)pyridine (CID 57099920) is 3-prop-2-enoxy-5-(2,2,2-trichloroethyl)pyridine.
What is the SMILES notation for 3-prop-2-enoxy-5-(2,2,2-trichloroethyl)pyridine?
The canonical SMILES for 3-prop-2-enoxy-5-(2,2,2-trichloroethyl)pyridine is C=CCOc1cncc(CC(Cl)(Cl)Cl)c1.
What is the InChIKey of 3-prop-2-enoxy-5-(2,2,2-trichloroethyl)pyridine?
The InChIKey is ABVHZQGNCJGYBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10Cl3NO/c1-2-3-15-9-4-8(6-14-7-9)5-10(11,12)13/h2,4,6-7H,1,3,5H2.
What are the key properties of 3-prop-2-enoxy-5-(2,2,2-trichloroethyl)pyridine?
3-prop-2-enoxy-5-(2,2,2-trichloroethyl)pyridine has a molecular weight of 266.56 g/mol, XLogP of 3.56, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-prop-2-enoxy-5-(2,2,2-trichloroethyl)pyridine is sourced from PubChem (CID 57099920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).