C18H26FNO — CID 57099971
(4bS,8aR)-4b-[2-(dimethylamino)ethyl]-3-fluoro-5,6,7,8,9,10-hexahydrophenanthren-8a-ol (PubChem CID 57099971) has the molecular formula C18H26FNO and a molecular weight of 291.41 g/mol. Its IUPAC name is (4bS,8aR)-4b-[2-(dimethylamino)ethyl]-3-fluoro-5,6,7,8,9,10-hexahydrophenanthren-8a-ol.
| Compound Name | (4bS,8aR)-4b-[2-(dimethylamino)ethyl]-3-fluoro-5,6,7,8,9,10-hexahydrophenanthren-8a-ol |
|---|---|
| PubChem CID | 57099971 |
| Molecular Formula | C18H26FNO |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | (4bS,8aR)-4b-[2-(dimethylamino)ethyl]-3-fluoro-5,6,7,8,9,10-hexahydrophenanthren-8a-ol |
| SMILES | CN(C)CC[C@]12CCCC[C@@]1(O)CCc1ccc(F)cc12 |
| InChI | InChI=1S/C18H26FNO/c1-20(2)12-11-17-8-3-4-9-18(17,21)10-7-14-5-6-15(19)13-16(14)17/h5-6,13,21H,3-4,7-12H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | PEOXCGSPURAQFX-ZWKOTPCHSA-N |
| XLogP | 3.27 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |