C52H54F3N5O5S — CID 57100079
N-[2-[[(2S)-5-(5-methyl-1-tritylimidazol-4-yl)-1-oxo-1-[4-(trifluoromethyl)piperidin-1-yl]pentan-2-yl]sulfamoyl]-6-phenylphenyl]-N-propanoylpropanamide (PubChem CID 57100079) has the molecular formula C52H54F3N5O5S and a molecular weight of 918.10 g/mol. Its IUPAC name is N-[2-[[(2S)-5-(5-methyl-1-tritylimidazol-4-yl)-1-oxo-1-[4-(trifluoromethyl)piperidin-1-yl]pentan-2-yl]sulfamoyl]-6-phenylphenyl]-N-propanoylpropanamide.
| Compound Name | N-[2-[[(2S)-5-(5-methyl-1-tritylimidazol-4-yl)-1-oxo-1-[4-(trifluoromethyl)piperidin-1-yl]pentan-2-yl]sulfamoyl]-6-phenylphenyl]-N-propanoylpropanamide |
|---|---|
| PubChem CID | 57100079 |
| Molecular Formula | C52H54F3N5O5S |
| Molecular Weight | 918.10 g/mol |
| Exact Mass | 917.38 |
| IUPAC Name | N-[2-[[(2S)-5-(5-methyl-1-tritylimidazol-4-yl)-1-oxo-1-[4-(trifluoromethyl)piperidin-1-yl]pentan-2-yl]sulfamoyl]-6-phenylphenyl]-N-propanoylpropanamide |
| SMILES | CCC(=O)N(C(=O)CC)c1c(-c2ccccc2)cccc1S(=O)(=O)N[C@@H](CCCc1ncn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c1C)C(=O)N1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C52H54F3N5O5S/c1-4-47(61)60(48(62)5-2)49-43(38-20-10-6-11-21-38)28-18-31-46(49)66(64,65)57-45(50(63)58-34-32-42(33-35-58)52(53,54)55)30-19-29-44-37(3)59(36-56-44)51(39-22-12-7-13-23-39,40-24-14-8-15-25-40)41-26-16-9-17-27-41/h6-18,20-28,31,36,42,45,57H,4-5,19,29-30,32-35H2,1-3H3/t45-/m0/s1 |
| InChIKey | HTSBJSNFWASOGO-GWHBCOKCSA-N |
| XLogP | 9.85 |
| TPSA | 121.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.10 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|