C15H19FN2O3S — CID 57100090
(3S,6R)-1-[(4-fluorophenyl)methyl]-6-(2-hydroxyethylsulfanylmethyl)-3-methylpiperazine-2,5-dione (PubChem CID 57100090) has the molecular formula C15H19FN2O3S and a molecular weight of 326.39 g/mol. Its IUPAC name is (3S,6R)-1-[(4-fluorophenyl)methyl]-6-(2-hydroxyethylsulfanylmethyl)-3-methylpiperazine-2,5-dione.
| Compound Name | (3S,6R)-1-[(4-fluorophenyl)methyl]-6-(2-hydroxyethylsulfanylmethyl)-3-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 57100090 |
| Molecular Formula | C15H19FN2O3S |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | (3S,6R)-1-[(4-fluorophenyl)methyl]-6-(2-hydroxyethylsulfanylmethyl)-3-methylpiperazine-2,5-dione |
| SMILES | C[C@@H]1NC(=O)[C@H](CSCCO)N(Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C15H19FN2O3S/c1-10-15(21)18(8-11-2-4-12(16)5-3-11)13(14(20)17-10)9-22-7-6-19/h2-5,10,13,19H,6-9H2,1H3,(H,17,20)/t10-,13-/m0/s1 |
| InChIKey | UUZKPQORSVJNEX-GWCFXTLKSA-N |
| XLogP | 0.77 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|