C21H31ClN2O3S — CID 57100122
(8aR,12aS,13aS)-12-(3-chloropropylsulfonyl)-3-ethoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine (PubChem CID 57100122) has the molecular formula C21H31ClN2O3S and a molecular weight of 427.01 g/mol. Its IUPAC name is (8aR,12aS,13aS)-12-(3-chloropropylsulfonyl)-3-ethoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine.
| Compound Name | (8aR,12aS,13aS)-12-(3-chloropropylsulfonyl)-3-ethoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine |
|---|---|
| PubChem CID | 57100122 |
| Molecular Formula | C21H31ClN2O3S |
| Molecular Weight | 427.01 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | (8aR,12aS,13aS)-12-(3-chloropropylsulfonyl)-3-ethoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine |
| SMILES | CCOc1ccc2c(c1)CCN1C[C@H]3CCCN(S(=O)(=O)CCCCl)[C@H]3C[C@@H]21 |
| InChI | InChI=1S/C21H31ClN2O3S/c1-2-27-18-6-7-19-16(13-18)8-11-23-15-17-5-3-10-24(20(17)14-21(19)23)28(25,26)12-4-9-22/h6-7,13,17,20-21H,2-5,8-12,14-15H2,1H3/t17-,20+,21+/m1/s1 |
| InChIKey | XSXQXXWJRDOGKS-QMMLZNLJSA-N |
| XLogP | 3.43 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.01 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|