About (3S)-3-benzyl-2-methoxy-6-quinolin-2-yl-3,4-dihydrochromen-2-ol
(3S)-3-benzyl-2-methoxy-6-quinolin-2-yl-3,4-dihydrochromen-2-ol (PubChem CID 57100130) has the molecular formula C26H23NO3
and a molecular weight of 397.47 g/mol. Its IUPAC name is (3S)-3-benzyl-2-methoxy-6-quinolin-2-yl-3,4-dihydrochromen-2-ol.
Molecular Properties
| Compound Name | (3S)-3-benzyl-2-methoxy-6-quinolin-2-yl-3,4-dihydrochromen-2-ol |
| PubChem CID | 57100130 |
| Molecular Formula | C26H23NO3 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | (3S)-3-benzyl-2-methoxy-6-quinolin-2-yl-3,4-dihydrochromen-2-ol |
| SMILES | COC1(O)Oc2ccc(-c3ccc4ccccc4n3)cc2C[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C26H23NO3/c1-29-26(28)22(15-18-7-3-2-4-8-18)17-21-16-20(12-14-25(21)30-26)24-13-11-19-9-5-6-10-23(19)27-24/h2-14,16,22,28H,15,17H2,1H3/t22-,26?/m0/s1 |
| InChIKey | SNZURPCKJJFUGI-CHQVSRGASA-N |
| XLogP | 4.99 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-benzyl-2-methoxy-6-quinolin-2-yl-3,4-dihydrochromen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-benzyl-2-methoxy-6-quinolin-2-yl-3,4-dihydrochromen-2-ol?
The IUPAC name of (3S)-3-benzyl-2-methoxy-6-quinolin-2-yl-3,4-dihydrochromen-2-ol (CID 57100130) is (3S)-3-benzyl-2-methoxy-6-quinolin-2-yl-3,4-dihydrochromen-2-ol.
What is the SMILES notation for (3S)-3-benzyl-2-methoxy-6-quinolin-2-yl-3,4-dihydrochromen-2-ol?
The canonical SMILES for (3S)-3-benzyl-2-methoxy-6-quinolin-2-yl-3,4-dihydrochromen-2-ol is COC1(O)Oc2ccc(-c3ccc4ccccc4n3)cc2C[C@@H]1Cc1ccccc1.
What is the InChIKey of (3S)-3-benzyl-2-methoxy-6-quinolin-2-yl-3,4-dihydrochromen-2-ol?
The InChIKey is SNZURPCKJJFUGI-CHQVSRGASA-N. The full InChI is InChI=1S/C26H23NO3/c1-29-26(28)22(15-18-7-3-2-4-8-18)17-21-16-20(12-14-25(21)30-26)24-13-11-19-9-5-6-10-23(19)27-24/h2-14,16,22,28H,15,17H2,1H3/t22-,26?/m0/s1.
What are the key properties of (3S)-3-benzyl-2-methoxy-6-quinolin-2-yl-3,4-dihydrochromen-2-ol?
(3S)-3-benzyl-2-methoxy-6-quinolin-2-yl-3,4-dihydrochromen-2-ol has a molecular weight of 397.47 g/mol, XLogP of 4.99, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-benzyl-2-methoxy-6-quinolin-2-yl-3,4-dihydrochromen-2-ol is sourced from PubChem (CID 57100130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).