About 4,5-dihydroimidazol-1-yl sulfite
4,5-dihydroimidazol-1-yl sulfite (PubChem CID 57100492) has the molecular formula C3H5N2O3S-
and a molecular weight of 149.15 g/mol. Its IUPAC name is 4,5-dihydroimidazol-1-yl sulfite.
Molecular Properties
| Compound Name | 4,5-dihydroimidazol-1-yl sulfite |
| PubChem CID | 57100492 |
| Molecular Formula | C3H5N2O3S- |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.00 |
| IUPAC Name | 4,5-dihydroimidazol-1-yl sulfite |
| SMILES | O=S([O-])ON1C=NCC1 |
| InChI | InChI=1S/C3H6N2O3S/c6-9(7)8-5-2-1-4-3-5/h3H,1-2H2,(H,6,7)/p-1 |
| InChIKey | AUTZMVSGZTUGDC-UHFFFAOYSA-M |
| XLogP | -0.94 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dihydroimidazol-1-yl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydroimidazol-1-yl sulfite?
The IUPAC name of 4,5-dihydroimidazol-1-yl sulfite (CID 57100492) is 4,5-dihydroimidazol-1-yl sulfite.
What is the SMILES notation for 4,5-dihydroimidazol-1-yl sulfite?
The canonical SMILES for 4,5-dihydroimidazol-1-yl sulfite is O=S([O-])ON1C=NCC1.
What is the InChIKey of 4,5-dihydroimidazol-1-yl sulfite?
The InChIKey is AUTZMVSGZTUGDC-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H6N2O3S/c6-9(7)8-5-2-1-4-3-5/h3H,1-2H2,(H,6,7)/p-1.
What are the key properties of 4,5-dihydroimidazol-1-yl sulfite?
4,5-dihydroimidazol-1-yl sulfite has a molecular weight of 149.15 g/mol, XLogP of -0.94, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydroimidazol-1-yl sulfite is sourced from PubChem (CID 57100492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).