About 8-[4-(3,4-dihydro-2H-chromen-8-ylsulfanyloxy)butyl]-8-azaspiro[4.5]decane-7,9-dione
8-[4-(3,4-dihydro-2H-chromen-8-ylsulfanyloxy)butyl]-8-azaspiro[4.5]decane-7,9-dione (PubChem CID 57101431) has the molecular formula C22H29NO4S
and a molecular weight of 403.54 g/mol. Its IUPAC name is 8-[4-(3,4-dihydro-2H-chromen-8-ylsulfanyloxy)butyl]-8-azaspiro[4.5]decane-7,9-dione.
Molecular Properties
| Compound Name | 8-[4-(3,4-dihydro-2H-chromen-8-ylsulfanyloxy)butyl]-8-azaspiro[4.5]decane-7,9-dione |
| PubChem CID | 57101431 |
| Molecular Formula | C22H29NO4S |
| Molecular Weight | 403.54 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 8-[4-(3,4-dihydro-2H-chromen-8-ylsulfanyloxy)butyl]-8-azaspiro[4.5]decane-7,9-dione |
| SMILES | O=C1CC2(CCCC2)CC(=O)N1CCCCOSc1cccc2c1OCCC2 |
| InChI | InChI=1S/C22H29NO4S/c24-19-15-22(10-1-2-11-22)16-20(25)23(19)12-3-4-14-27-28-18-9-5-7-17-8-6-13-26-21(17)18/h5,7,9H,1-4,6,8,10-16H2 |
| InChIKey | FFCJKJIMQVCJOA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.54 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-[4-(3,4-dihydro-2H-chromen-8-ylsulfanyloxy)butyl]-8-azaspiro[4.5]decane-7,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[4-(3,4-dihydro-2H-chromen-8-ylsulfanyloxy)butyl]-8-azaspiro[4.5]decane-7,9-dione?
The IUPAC name of 8-[4-(3,4-dihydro-2H-chromen-8-ylsulfanyloxy)butyl]-8-azaspiro[4.5]decane-7,9-dione (CID 57101431) is 8-[4-(3,4-dihydro-2H-chromen-8-ylsulfanyloxy)butyl]-8-azaspiro[4.5]decane-7,9-dione.
What is the SMILES notation for 8-[4-(3,4-dihydro-2H-chromen-8-ylsulfanyloxy)butyl]-8-azaspiro[4.5]decane-7,9-dione?
The canonical SMILES for 8-[4-(3,4-dihydro-2H-chromen-8-ylsulfanyloxy)butyl]-8-azaspiro[4.5]decane-7,9-dione is O=C1CC2(CCCC2)CC(=O)N1CCCCOSc1cccc2c1OCCC2.
What is the InChIKey of 8-[4-(3,4-dihydro-2H-chromen-8-ylsulfanyloxy)butyl]-8-azaspiro[4.5]decane-7,9-dione?
The InChIKey is FFCJKJIMQVCJOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29NO4S/c24-19-15-22(10-1-2-11-22)16-20(25)23(19)12-3-4-14-27-28-18-9-5-7-17-8-6-13-26-21(17)18/h5,7,9H,1-4,6,8,10-16H2.
What are the key properties of 8-[4-(3,4-dihydro-2H-chromen-8-ylsulfanyloxy)butyl]-8-azaspiro[4.5]decane-7,9-dione?
8-[4-(3,4-dihydro-2H-chromen-8-ylsulfanyloxy)butyl]-8-azaspiro[4.5]decane-7,9-dione has a molecular weight of 403.54 g/mol, XLogP of 4.52, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[4-(3,4-dihydro-2H-chromen-8-ylsulfanyloxy)butyl]-8-azaspiro[4.5]decane-7,9-dione is sourced from PubChem (CID 57101431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).