C11H11N — CID 57101705
1,2,3,8b-tetrahydroindeno[1,2-c]pyrrole (PubChem CID 57101705) has the molecular formula C11H11N and a molecular weight of 157.22 g/mol. Its IUPAC name is 1,2,3,8b-tetrahydroindeno[1,2-c]pyrrole.
| Compound Name | 1,2,3,8b-tetrahydroindeno[1,2-c]pyrrole |
|---|---|
| PubChem CID | 57101705 |
| Molecular Formula | C11H11N |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 1,2,3,8b-tetrahydroindeno[1,2-c]pyrrole |
| SMILES | C1=C2CNCC2c2ccccc21 |
| InChI | InChI=1S/C11H11N/c1-2-4-10-8(3-1)5-9-6-12-7-11(9)10/h1-5,11-12H,6-7H2 |
| InChIKey | KPIAFOCHUMUYNS-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |