C20H20F2N4O4 — CID 57101780
2-[2-[[[3-(2,4-difluorophenyl)-3-methoxyiminoprop-1-en-2-yl]amino]oxymethyl]phenyl]-2-methoxyiminoacetamide (PubChem CID 57101780) has the molecular formula C20H20F2N4O4 and a molecular weight of 418.40 g/mol. Its IUPAC name is 2-[2-[[[3-(2,4-difluorophenyl)-3-methoxyiminoprop-1-en-2-yl]amino]oxymethyl]phenyl]-2-methoxyiminoacetamide.
| Compound Name | 2-[2-[[[3-(2,4-difluorophenyl)-3-methoxyiminoprop-1-en-2-yl]amino]oxymethyl]phenyl]-2-methoxyiminoacetamide |
|---|---|
| PubChem CID | 57101780 |
| Molecular Formula | C20H20F2N4O4 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 2-[2-[[[3-(2,4-difluorophenyl)-3-methoxyiminoprop-1-en-2-yl]amino]oxymethyl]phenyl]-2-methoxyiminoacetamide |
| SMILES | C=C(NOCc1ccccc1C(=NOC)C(N)=O)C(=NOC)c1ccc(F)cc1F |
| InChI | InChI=1S/C20H20F2N4O4/c1-12(18(25-28-2)16-9-8-14(21)10-17(16)22)24-30-11-13-6-4-5-7-15(13)19(20(23)27)26-29-3/h4-10,24H,1,11H2,2-3H3,(H2,23,27) |
| InChIKey | UFJYCVCYLUVRFL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|