C14H20N6O5PS2+ — CID 57103006
bis[3-acetylsulfanyl-3-(1H-1,2,4-triazol-5-yl)propoxy]-oxophosphanium (PubChem CID 57103006) has the molecular formula C14H20N6O5PS2+ and a molecular weight of 447.46 g/mol. Its IUPAC name is bis[3-acetylsulfanyl-3-(1H-1,2,4-triazol-5-yl)propoxy]-oxophosphanium.
| Compound Name | bis[3-acetylsulfanyl-3-(1H-1,2,4-triazol-5-yl)propoxy]-oxophosphanium |
|---|---|
| PubChem CID | 57103006 |
| Molecular Formula | C14H20N6O5PS2+ |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | bis[3-acetylsulfanyl-3-(1H-1,2,4-triazol-5-yl)propoxy]-oxophosphanium |
| SMILES | CC(=O)SC(CCO[P+](=O)OCCC(SC(C)=O)c1ncn[nH]1)c1ncn[nH]1 |
| InChI | InChI=1S/C14H20N6O5PS2/c1-9(21)27-11(13-15-7-17-19-13)3-5-24-26(23)25-6-4-12(28-10(2)22)14-16-8-18-20-14/h7-8,11-12H,3-6H2,1-2H3,(H,15,17,19)(H,16,18,20)/q+1 |
| InChIKey | BIQINQCRVYUSDT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 152.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|