C15H26N4O2S — CID 57103098
2,6-diethyl-4-(2-piperidin-1-ylethyliminomethyl)-1,2,6-thiadiazinane-3,5-dione (PubChem CID 57103098) has the molecular formula C15H26N4O2S and a molecular weight of 326.47 g/mol. Its IUPAC name is 2,6-diethyl-4-(2-piperidin-1-ylethyliminomethyl)-1,2,6-thiadiazinane-3,5-dione.
| Compound Name | 2,6-diethyl-4-(2-piperidin-1-ylethyliminomethyl)-1,2,6-thiadiazinane-3,5-dione |
|---|---|
| PubChem CID | 57103098 |
| Molecular Formula | C15H26N4O2S |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 2,6-diethyl-4-(2-piperidin-1-ylethyliminomethyl)-1,2,6-thiadiazinane-3,5-dione |
| SMILES | CCN1SN(CC)C(=O)C(/C=N/CCN2CCCCC2)C1=O |
| InChI | InChI=1S/C15H26N4O2S/c1-3-18-14(20)13(15(21)19(4-2)22-18)12-16-8-11-17-9-6-5-7-10-17/h12-13H,3-11H2,1-2H3/b16-12+ |
| InChIKey | NIJRGMMZAIXNHG-FOWTUZBSSA-N |
| XLogP | 1.43 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|