C21H34O7 — CID 57103180
acetyl (1S,2R,4R)-2-(7-methoxy-7-oxoheptyl)-4-[(2R)-oxan-2-yl]oxycyclopentane-1-carboxylate (PubChem CID 57103180) has the molecular formula C21H34O7 and a molecular weight of 398.50 g/mol. Its IUPAC name is acetyl (1S,2R,4R)-2-(7-methoxy-7-oxoheptyl)-4-[(2R)-oxan-2-yl]oxycyclopentane-1-carboxylate.
| Compound Name | acetyl (1S,2R,4R)-2-(7-methoxy-7-oxoheptyl)-4-[(2R)-oxan-2-yl]oxycyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 57103180 |
| Molecular Formula | C21H34O7 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | acetyl (1S,2R,4R)-2-(7-methoxy-7-oxoheptyl)-4-[(2R)-oxan-2-yl]oxycyclopentane-1-carboxylate |
| SMILES | COC(=O)CCCCCC[C@@H]1C[C@@H](O[C@@H]2CCCCO2)C[C@@H]1C(=O)OC(C)=O |
| InChI | InChI=1S/C21H34O7/c1-15(22)27-21(24)18-14-17(28-20-11-7-8-12-26-20)13-16(18)9-5-3-4-6-10-19(23)25-2/h16-18,20H,3-14H2,1-2H3/t16-,17-,18+,20-/m1/s1 |
| InChIKey | FQPMPBLQGITLII-FTEYMNFISA-N |
| XLogP | 3.53 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|