About 5-chloro-2-[(3-methyl-3,4-dihydropyridin-2-yl)amino]phenol
5-chloro-2-[(3-methyl-3,4-dihydropyridin-2-yl)amino]phenol (PubChem CID 57103399) has the molecular formula C12H13ClN2O
and a molecular weight of 236.70 g/mol. Its IUPAC name is 5-chloro-2-[(3-methyl-3,4-dihydropyridin-2-yl)amino]phenol.
Molecular Properties
| Compound Name | 5-chloro-2-[(3-methyl-3,4-dihydropyridin-2-yl)amino]phenol |
| PubChem CID | 57103399 |
| Molecular Formula | C12H13ClN2O |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 5-chloro-2-[(3-methyl-3,4-dihydropyridin-2-yl)amino]phenol |
| SMILES | CC1CC=CN=C1Nc1ccc(Cl)cc1O |
| InChI | InChI=1S/C12H13ClN2O/c1-8-3-2-6-14-12(8)15-10-5-4-9(13)7-11(10)16/h2,4-8,16H,3H2,1H3,(H,14,15) |
| InChIKey | RMXPVGJSERPNCG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-[(3-methyl-3,4-dihydropyridin-2-yl)amino]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-[(3-methyl-3,4-dihydropyridin-2-yl)amino]phenol?
The IUPAC name of 5-chloro-2-[(3-methyl-3,4-dihydropyridin-2-yl)amino]phenol (CID 57103399) is 5-chloro-2-[(3-methyl-3,4-dihydropyridin-2-yl)amino]phenol.
What is the SMILES notation for 5-chloro-2-[(3-methyl-3,4-dihydropyridin-2-yl)amino]phenol?
The canonical SMILES for 5-chloro-2-[(3-methyl-3,4-dihydropyridin-2-yl)amino]phenol is CC1CC=CN=C1Nc1ccc(Cl)cc1O.
What is the InChIKey of 5-chloro-2-[(3-methyl-3,4-dihydropyridin-2-yl)amino]phenol?
The InChIKey is RMXPVGJSERPNCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN2O/c1-8-3-2-6-14-12(8)15-10-5-4-9(13)7-11(10)16/h2,4-8,16H,3H2,1H3,(H,14,15).
What are the key properties of 5-chloro-2-[(3-methyl-3,4-dihydropyridin-2-yl)amino]phenol?
5-chloro-2-[(3-methyl-3,4-dihydropyridin-2-yl)amino]phenol has a molecular weight of 236.70 g/mol, XLogP of 3.41, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-[(3-methyl-3,4-dihydropyridin-2-yl)amino]phenol is sourced from PubChem (CID 57103399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).