C21H36O3 — CID 57103429
tert-butyl 3-hydroxy-5,9,13-trimethyltetradeca-4,8,12-trienoate (PubChem CID 57103429) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is tert-butyl 3-hydroxy-5,9,13-trimethyltetradeca-4,8,12-trienoate.
| Compound Name | tert-butyl 3-hydroxy-5,9,13-trimethyltetradeca-4,8,12-trienoate |
|---|---|
| PubChem CID | 57103429 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | tert-butyl 3-hydroxy-5,9,13-trimethyltetradeca-4,8,12-trienoate |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CC(O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H36O3/c1-16(2)10-8-11-17(3)12-9-13-18(4)14-19(22)15-20(23)24-21(5,6)7/h10,12,14,19,22H,8-9,11,13,15H2,1-7H3 |
| InChIKey | QLDZYUIQAQRQND-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|