About tert-butyl 5-(methoxyamino)-2,7-diazaspiro[3.4]oct-6-ene-2-carboxylate
tert-butyl 5-(methoxyamino)-2,7-diazaspiro[3.4]oct-6-ene-2-carboxylate (PubChem CID 57103971) has the molecular formula C12H21N3O3
and a molecular weight of 255.32 g/mol. Its IUPAC name is tert-butyl 5-(methoxyamino)-2,7-diazaspiro[3.4]oct-6-ene-2-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 5-(methoxyamino)-2,7-diazaspiro[3.4]oct-6-ene-2-carboxylate |
| PubChem CID | 57103971 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | tert-butyl 5-(methoxyamino)-2,7-diazaspiro[3.4]oct-6-ene-2-carboxylate |
| SMILES | CONC1C=NCC12CN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C12H21N3O3/c1-11(2,3)18-10(16)15-7-12(8-15)6-13-5-9(12)14-17-4/h5,9,14H,6-8H2,1-4H3 |
| InChIKey | GTTBPIBUTSAMIY-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 5-(methoxyamino)-2,7-diazaspiro[3.4]oct-6-ene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 5-(methoxyamino)-2,7-diazaspiro[3.4]oct-6-ene-2-carboxylate?
The IUPAC name of tert-butyl 5-(methoxyamino)-2,7-diazaspiro[3.4]oct-6-ene-2-carboxylate (CID 57103971) is tert-butyl 5-(methoxyamino)-2,7-diazaspiro[3.4]oct-6-ene-2-carboxylate.
What is the SMILES notation for tert-butyl 5-(methoxyamino)-2,7-diazaspiro[3.4]oct-6-ene-2-carboxylate?
The canonical SMILES for tert-butyl 5-(methoxyamino)-2,7-diazaspiro[3.4]oct-6-ene-2-carboxylate is CONC1C=NCC12CN(C(=O)OC(C)(C)C)C2.
What is the InChIKey of tert-butyl 5-(methoxyamino)-2,7-diazaspiro[3.4]oct-6-ene-2-carboxylate?
The InChIKey is GTTBPIBUTSAMIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O3/c1-11(2,3)18-10(16)15-7-12(8-15)6-13-5-9(12)14-17-4/h5,9,14H,6-8H2,1-4H3.
What are the key properties of tert-butyl 5-(methoxyamino)-2,7-diazaspiro[3.4]oct-6-ene-2-carboxylate?
tert-butyl 5-(methoxyamino)-2,7-diazaspiro[3.4]oct-6-ene-2-carboxylate has a molecular weight of 255.32 g/mol, XLogP of 0.83, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 5-(methoxyamino)-2,7-diazaspiro[3.4]oct-6-ene-2-carboxylate is sourced from PubChem (CID 57103971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).