C12H20F6O — CID 57104099
1,1,1-trifluoro-3,3-dimethyl-2-(1,1,1-trifluoro-3,3-dimethylbutan-2-yl)oxybutane (PubChem CID 57104099) has the molecular formula C12H20F6O and a molecular weight of 294.28 g/mol. Its IUPAC name is 1,1,1-trifluoro-3,3-dimethyl-2-(1,1,1-trifluoro-3,3-dimethylbutan-2-yl)oxybutane.
| Compound Name | 1,1,1-trifluoro-3,3-dimethyl-2-(1,1,1-trifluoro-3,3-dimethylbutan-2-yl)oxybutane |
|---|---|
| PubChem CID | 57104099 |
| Molecular Formula | C12H20F6O |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 1,1,1-trifluoro-3,3-dimethyl-2-(1,1,1-trifluoro-3,3-dimethylbutan-2-yl)oxybutane |
| SMILES | CC(C)(C)C(OC(C(C)(C)C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H20F6O/c1-9(2,3)7(11(13,14)15)19-8(10(4,5)6)12(16,17)18/h7-8H,1-6H3 |
| InChIKey | XWEDIEPXIMLWPH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |