C40H58F15N9 — CID 57104119
6,7,8,15,16,17,23,24,25,26,32,33,34,35,38-pentadecafluoro-N-octyl-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-amine (PubChem CID 57104119) has the molecular formula C40H58F15N9 and a molecular weight of 949.94 g/mol. Its IUPAC name is 6,7,8,15,16,17,23,24,25,26,32,33,34,35,38-pentadecafluoro-N-octyl-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-amine.
| Compound Name | 6,7,8,15,16,17,23,24,25,26,32,33,34,35,38-pentadecafluoro-N-octyl-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-amine |
|---|---|
| PubChem CID | 57104119 |
| Molecular Formula | C40H58F15N9 |
| Molecular Weight | 949.94 g/mol |
| Exact Mass | 949.46 |
| IUPAC Name | 6,7,8,15,16,17,23,24,25,26,32,33,34,35,38-pentadecafluoro-N-octyl-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-amine |
| SMILES | CCCCCCCCNC1C(F)C(F)C(F)C2C3NC4NC(NC5C6C(F)C(F)C(F)C(F)C6C(NC6NC(NC(N3)C12)C1C(F)C(F)C(F)C(F)C61)N5F)C1C(F)C(F)C(F)CC41 |
| InChI | InChI=1S/C40H58F15N9/c1-2-3-4-5-6-7-8-56-32-18-15(23(46)30(53)31(32)54)36-58-33-10-9-11(41)19(42)20(43)12(10)34(57-33)62-39-16-17(25(48)29(52)28(51)24(16)47)40(64(39)55)63-37-14-13(35(59-37)60-38(18)61-36)21(44)26(49)27(50)22(14)45/h10-40,56-63H,2-9H2,1H3 |
| InChIKey | GAJUIUXYZXGTAK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 99.48 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.94 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|