About 2-methylpent-2-enedial
2-methylpent-2-enedial (PubChem CID 57104172) has the molecular formula C6H8O2
and a molecular weight of 112.13 g/mol. Its IUPAC name is 2-methylpent-2-enedial.
Molecular Properties
| Compound Name | 2-methylpent-2-enedial |
| PubChem CID | 57104172 |
| Molecular Formula | C6H8O2 |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.05 |
| IUPAC Name | 2-methylpent-2-enedial |
| SMILES | CC(C=O)=CCC=O |
| InChI | InChI=1S/C6H8O2/c1-6(5-8)3-2-4-7/h3-5H,2H2,1H3 |
| InChIKey | XFHILRUZNAUFRY-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpent-2-enedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpent-2-enedial?
The IUPAC name of 2-methylpent-2-enedial (CID 57104172) is 2-methylpent-2-enedial.
What is the SMILES notation for 2-methylpent-2-enedial?
The canonical SMILES for 2-methylpent-2-enedial is CC(C=O)=CCC=O.
What is the InChIKey of 2-methylpent-2-enedial?
The InChIKey is XFHILRUZNAUFRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O2/c1-6(5-8)3-2-4-7/h3-5H,2H2,1H3.
What are the key properties of 2-methylpent-2-enedial?
2-methylpent-2-enedial has a molecular weight of 112.13 g/mol, XLogP of 0.72, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpent-2-enedial is sourced from PubChem (CID 57104172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).