About 1-hydrazinyl-N',N'-dimethylethane-1,2-diamine
1-hydrazinyl-N',N'-dimethylethane-1,2-diamine (PubChem CID 57104181) has the molecular formula C4H14N4
and a molecular weight of 118.18 g/mol. Its IUPAC name is 1-hydrazinyl-N',N'-dimethylethane-1,2-diamine.
Molecular Properties
| Compound Name | 1-hydrazinyl-N',N'-dimethylethane-1,2-diamine |
| PubChem CID | 57104181 |
| Molecular Formula | C4H14N4 |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.12 |
| IUPAC Name | 1-hydrazinyl-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CC(N)NN |
| InChI | InChI=1S/C4H14N4/c1-8(2)3-4(5)7-6/h4,7H,3,5-6H2,1-2H3 |
| InChIKey | UVFFAPLPKARMCT-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-hydrazinyl-N',N'-dimethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydrazinyl-N',N'-dimethylethane-1,2-diamine?
The IUPAC name of 1-hydrazinyl-N',N'-dimethylethane-1,2-diamine (CID 57104181) is 1-hydrazinyl-N',N'-dimethylethane-1,2-diamine.
What is the SMILES notation for 1-hydrazinyl-N',N'-dimethylethane-1,2-diamine?
The canonical SMILES for 1-hydrazinyl-N',N'-dimethylethane-1,2-diamine is CN(C)CC(N)NN.
What is the InChIKey of 1-hydrazinyl-N',N'-dimethylethane-1,2-diamine?
The InChIKey is UVFFAPLPKARMCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H14N4/c1-8(2)3-4(5)7-6/h4,7H,3,5-6H2,1-2H3.
What are the key properties of 1-hydrazinyl-N',N'-dimethylethane-1,2-diamine?
1-hydrazinyl-N',N'-dimethylethane-1,2-diamine has a molecular weight of 118.18 g/mol, XLogP of -1.70, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydrazinyl-N',N'-dimethylethane-1,2-diamine is sourced from PubChem (CID 57104181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).