C9H10 — CID 57104261
4-methylocta-1,2,4-trien-7-yne (PubChem CID 57104261) has the molecular formula C9H10 and a molecular weight of 118.18 g/mol. Its IUPAC name is 4-methylocta-1,2,4-trien-7-yne.
| Compound Name | 4-methylocta-1,2,4-trien-7-yne |
|---|---|
| PubChem CID | 57104261 |
| Molecular Formula | C9H10 |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.08 |
| IUPAC Name | 4-methylocta-1,2,4-trien-7-yne |
| SMILES | C#CCC=C(C)C=C=C |
| InChI | InChI=1S/C9H10/c1-4-6-8-9(3)7-5-2/h1,7-8H,2,6H2,3H3 |
| InChIKey | NOCCPJOLSNRJPR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|