C22H26INO — CID 57104501
(6aR,12bS)-6-butyl-10-iodo-3-methyl-6a,7,8,12b-tetrahydro-5H-benzo[a]phenanthridin-11-ol (PubChem CID 57104501) has the molecular formula C22H26INO and a molecular weight of 447.36 g/mol. Its IUPAC name is (6aR,12bS)-6-butyl-10-iodo-3-methyl-6a,7,8,12b-tetrahydro-5H-benzo[a]phenanthridin-11-ol.
| Compound Name | (6aR,12bS)-6-butyl-10-iodo-3-methyl-6a,7,8,12b-tetrahydro-5H-benzo[a]phenanthridin-11-ol |
|---|---|
| PubChem CID | 57104501 |
| Molecular Formula | C22H26INO |
| Molecular Weight | 447.36 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | (6aR,12bS)-6-butyl-10-iodo-3-methyl-6a,7,8,12b-tetrahydro-5H-benzo[a]phenanthridin-11-ol |
| SMILES | CCCCN1Cc2cc(C)ccc2[C@@H]2c3cc(O)c(I)cc3CC[C@H]21 |
| InChI | InChI=1S/C22H26INO/c1-3-4-9-24-13-16-10-14(2)5-7-17(16)22-18-12-21(25)19(23)11-15(18)6-8-20(22)24/h5,7,10-12,20,22,25H,3-4,6,8-9,13H2,1-2H3/t20-,22-/m1/s1 |
| InChIKey | QVQVISNIHDGYEL-IFMALSPDSA-N |
| XLogP | 5.37 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.36 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|