C13H19NO7S2 — CID 57104783
6-(1-hydroxyethyl)-4-methyl-3-(2-methylsulfonyloxyethylsulfanyl)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 57104783) has the molecular formula C13H19NO7S2 and a molecular weight of 365.43 g/mol. Its IUPAC name is 6-(1-hydroxyethyl)-4-methyl-3-(2-methylsulfonyloxyethylsulfanyl)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | 6-(1-hydroxyethyl)-4-methyl-3-(2-methylsulfonyloxyethylsulfanyl)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 57104783 |
| Molecular Formula | C13H19NO7S2 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 6-(1-hydroxyethyl)-4-methyl-3-(2-methylsulfonyloxyethylsulfanyl)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | CC(O)C1C(=O)N2C(C(=O)O)=C(SCCOS(C)(=O)=O)C(C)C12 |
| InChI | InChI=1S/C13H19NO7S2/c1-6-9-8(7(2)15)12(16)14(9)10(13(17)18)11(6)22-5-4-21-23(3,19)20/h6-9,15H,4-5H2,1-3H3,(H,17,18) |
| InChIKey | CQISHZPLSZNMIR-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|