C27H33N3O4 — CID 57104907
cyclohexylmethyl 2-[(3S,5S)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate (PubChem CID 57104907) has the molecular formula C27H33N3O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is cyclohexylmethyl 2-[(3S,5S)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate.
| Compound Name | cyclohexylmethyl 2-[(3S,5S)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 57104907 |
| Molecular Formula | C27H33N3O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | cyclohexylmethyl 2-[(3S,5S)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate |
| SMILES | [H]/N=C(\N)c1ccc(-c2ccc(OC[C@@H]3C[C@@H](CC(=O)OCC4CCCCC4)C(=O)N3)cc2)cc1 |
| InChI | InChI=1S/C27H33N3O4/c28-26(29)21-8-6-19(7-9-21)20-10-12-24(13-11-20)33-17-23-14-22(27(32)30-23)15-25(31)34-16-18-4-2-1-3-5-18/h6-13,18,22-23H,1-5,14-17H2,(H3,28,29)(H,30,32)/t22-,23-/m0/s1 |
| InChIKey | RJKYRNJVQYARAR-GOTSBHOMSA-N |
| XLogP | 4.03 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|