C11H12F4N3OS+ — CID 57105012
5-methyl-2-propyl-2-(2,3,5,6-tetrafluoro-4-pyridinyl)-1,2,5-thiadiazolidin-2-ium-3-one (PubChem CID 57105012) has the molecular formula C11H12F4N3OS+ and a molecular weight of 310.30 g/mol. Its IUPAC name is 5-methyl-2-propyl-2-(2,3,5,6-tetrafluoro-4-pyridinyl)-1,2,5-thiadiazolidin-2-ium-3-one.
| Compound Name | 5-methyl-2-propyl-2-(2,3,5,6-tetrafluoro-4-pyridinyl)-1,2,5-thiadiazolidin-2-ium-3-one |
|---|---|
| PubChem CID | 57105012 |
| Molecular Formula | C11H12F4N3OS+ |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 5-methyl-2-propyl-2-(2,3,5,6-tetrafluoro-4-pyridinyl)-1,2,5-thiadiazolidin-2-ium-3-one |
| SMILES | CCC[N+]1(c2c(F)c(F)nc(F)c2F)SN(C)CC1=O |
| InChI | InChI=1S/C11H12F4N3OS/c1-3-4-18(6(19)5-17(2)20-18)9-7(12)10(14)16-11(15)8(9)13/h3-5H2,1-2H3/q+1 |
| InChIKey | WQZLCQUUQGGUBS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|