About 5-[(3-ethylphenyl)methyl]-1,2-thiazole
5-[(3-ethylphenyl)methyl]-1,2-thiazole (PubChem CID 57105084) has the molecular formula C12H13NS
and a molecular weight of 203.31 g/mol. Its IUPAC name is 5-[(3-ethylphenyl)methyl]-1,2-thiazole.
Molecular Properties
| Compound Name | 5-[(3-ethylphenyl)methyl]-1,2-thiazole |
| PubChem CID | 57105084 |
| Molecular Formula | C12H13NS |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 5-[(3-ethylphenyl)methyl]-1,2-thiazole |
| SMILES | CCc1cccc(Cc2ccns2)c1 |
| InChI | InChI=1S/C12H13NS/c1-2-10-4-3-5-11(8-10)9-12-6-7-13-14-12/h3-8H,2,9H2,1H3 |
| InChIKey | SDUMJWKMYIWKDP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(3-ethylphenyl)methyl]-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3-ethylphenyl)methyl]-1,2-thiazole?
The IUPAC name of 5-[(3-ethylphenyl)methyl]-1,2-thiazole (CID 57105084) is 5-[(3-ethylphenyl)methyl]-1,2-thiazole.
What is the SMILES notation for 5-[(3-ethylphenyl)methyl]-1,2-thiazole?
The canonical SMILES for 5-[(3-ethylphenyl)methyl]-1,2-thiazole is CCc1cccc(Cc2ccns2)c1.
What is the InChIKey of 5-[(3-ethylphenyl)methyl]-1,2-thiazole?
The InChIKey is SDUMJWKMYIWKDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NS/c1-2-10-4-3-5-11(8-10)9-12-6-7-13-14-12/h3-8H,2,9H2,1H3.
What are the key properties of 5-[(3-ethylphenyl)methyl]-1,2-thiazole?
5-[(3-ethylphenyl)methyl]-1,2-thiazole has a molecular weight of 203.31 g/mol, XLogP of 3.30, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3-ethylphenyl)methyl]-1,2-thiazole is sourced from PubChem (CID 57105084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).