About [1-[3-bromo-4-[1-(3-fluorobutanoyloxy)cyclohexyl]phenyl]cyclohexyl] 3-fluorobutanoate
[1-[3-bromo-4-[1-(3-fluorobutanoyloxy)cyclohexyl]phenyl]cyclohexyl] 3-fluorobutanoate (PubChem CID 57105290) has the molecular formula C26H35BrF2O4
and a molecular weight of 529.46 g/mol. Its IUPAC name is [1-[3-bromo-4-[1-(3-fluorobutanoyloxy)cyclohexyl]phenyl]cyclohexyl] 3-fluorobutanoate.
Molecular Properties
| Compound Name | [1-[3-bromo-4-[1-(3-fluorobutanoyloxy)cyclohexyl]phenyl]cyclohexyl] 3-fluorobutanoate |
| PubChem CID | 57105290 |
| Molecular Formula | C26H35BrF2O4 |
| Molecular Weight | 529.46 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | [1-[3-bromo-4-[1-(3-fluorobutanoyloxy)cyclohexyl]phenyl]cyclohexyl] 3-fluorobutanoate |
| SMILES | CC(F)CC(=O)OC1(c2ccc(C3(OC(=O)CC(C)F)CCCCC3)c(Br)c2)CCCCC1 |
| InChI | InChI=1S/C26H35BrF2O4/c1-18(28)15-23(30)32-25(11-5-3-6-12-25)20-9-10-21(22(27)17-20)26(13-7-4-8-14-26)33-24(31)16-19(2)29/h9-10,17-19H,3-8,11-16H2,1-2H3 |
| InChIKey | VYYTVZYUFHYRLU-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 529.46 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[3-bromo-4-[1-(3-fluorobutanoyloxy)cyclohexyl]phenyl]cyclohexyl] 3-fluorobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[3-bromo-4-[1-(3-fluorobutanoyloxy)cyclohexyl]phenyl]cyclohexyl] 3-fluorobutanoate?
The IUPAC name of [1-[3-bromo-4-[1-(3-fluorobutanoyloxy)cyclohexyl]phenyl]cyclohexyl] 3-fluorobutanoate (CID 57105290) is [1-[3-bromo-4-[1-(3-fluorobutanoyloxy)cyclohexyl]phenyl]cyclohexyl] 3-fluorobutanoate.
What is the SMILES notation for [1-[3-bromo-4-[1-(3-fluorobutanoyloxy)cyclohexyl]phenyl]cyclohexyl] 3-fluorobutanoate?
The canonical SMILES for [1-[3-bromo-4-[1-(3-fluorobutanoyloxy)cyclohexyl]phenyl]cyclohexyl] 3-fluorobutanoate is CC(F)CC(=O)OC1(c2ccc(C3(OC(=O)CC(C)F)CCCCC3)c(Br)c2)CCCCC1.
What is the InChIKey of [1-[3-bromo-4-[1-(3-fluorobutanoyloxy)cyclohexyl]phenyl]cyclohexyl] 3-fluorobutanoate?
The InChIKey is VYYTVZYUFHYRLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H35BrF2O4/c1-18(28)15-23(30)32-25(11-5-3-6-12-25)20-9-10-21(22(27)17-20)26(13-7-4-8-14-26)33-24(31)16-19(2)29/h9-10,17-19H,3-8,11-16H2,1-2H3.
What are the key properties of [1-[3-bromo-4-[1-(3-fluorobutanoyloxy)cyclohexyl]phenyl]cyclohexyl] 3-fluorobutanoate?
[1-[3-bromo-4-[1-(3-fluorobutanoyloxy)cyclohexyl]phenyl]cyclohexyl] 3-fluorobutanoate has a molecular weight of 529.46 g/mol, XLogP of 7.35, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[3-bromo-4-[1-(3-fluorobutanoyloxy)cyclohexyl]phenyl]cyclohexyl] 3-fluorobutanoate is sourced from PubChem (CID 57105290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).