About (2S)-2-(5-hydroxy-4,8-dimethylnon-7-enyl)-6-(2-hydroxyethylidene)-2-methyloxepan-3-one
(2S)-2-(5-hydroxy-4,8-dimethylnon-7-enyl)-6-(2-hydroxyethylidene)-2-methyloxepan-3-one (PubChem CID 57105352) has the molecular formula C20H34O4
and a molecular weight of 338.49 g/mol. Its IUPAC name is (2S)-2-(5-hydroxy-4,8-dimethylnon-7-enyl)-6-(2-hydroxyethylidene)-2-methyloxepan-3-one.
Molecular Properties
| Compound Name | (2S)-2-(5-hydroxy-4,8-dimethylnon-7-enyl)-6-(2-hydroxyethylidene)-2-methyloxepan-3-one |
| PubChem CID | 57105352 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | (2S)-2-(5-hydroxy-4,8-dimethylnon-7-enyl)-6-(2-hydroxyethylidene)-2-methyloxepan-3-one |
| SMILES | CC(C)=CCC(O)C(C)CCC[C@]1(C)OCC(=CCO)CCC1=O |
| InChI | InChI=1S/C20H34O4/c1-15(2)7-9-18(22)16(3)6-5-12-20(4)19(23)10-8-17(11-13-21)14-24-20/h7,11,16,18,21-22H,5-6,8-10,12-14H2,1-4H3/t16?,18?,20-/m0/s1 |
| InChIKey | YJQJQUKZGNAQIV-NLPFYKDJSA-N |
| XLogP | 3.57 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-(5-hydroxy-4,8-dimethylnon-7-enyl)-6-(2-hydroxyethylidene)-2-methyloxepan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(5-hydroxy-4,8-dimethylnon-7-enyl)-6-(2-hydroxyethylidene)-2-methyloxepan-3-one?
The IUPAC name of (2S)-2-(5-hydroxy-4,8-dimethylnon-7-enyl)-6-(2-hydroxyethylidene)-2-methyloxepan-3-one (CID 57105352) is (2S)-2-(5-hydroxy-4,8-dimethylnon-7-enyl)-6-(2-hydroxyethylidene)-2-methyloxepan-3-one.
What is the SMILES notation for (2S)-2-(5-hydroxy-4,8-dimethylnon-7-enyl)-6-(2-hydroxyethylidene)-2-methyloxepan-3-one?
The canonical SMILES for (2S)-2-(5-hydroxy-4,8-dimethylnon-7-enyl)-6-(2-hydroxyethylidene)-2-methyloxepan-3-one is CC(C)=CCC(O)C(C)CCC[C@]1(C)OCC(=CCO)CCC1=O.
What is the InChIKey of (2S)-2-(5-hydroxy-4,8-dimethylnon-7-enyl)-6-(2-hydroxyethylidene)-2-methyloxepan-3-one?
The InChIKey is YJQJQUKZGNAQIV-NLPFYKDJSA-N. The full InChI is InChI=1S/C20H34O4/c1-15(2)7-9-18(22)16(3)6-5-12-20(4)19(23)10-8-17(11-13-21)14-24-20/h7,11,16,18,21-22H,5-6,8-10,12-14H2,1-4H3/t16?,18?,20-/m0/s1.
What are the key properties of (2S)-2-(5-hydroxy-4,8-dimethylnon-7-enyl)-6-(2-hydroxyethylidene)-2-methyloxepan-3-one?
(2S)-2-(5-hydroxy-4,8-dimethylnon-7-enyl)-6-(2-hydroxyethylidene)-2-methyloxepan-3-one has a molecular weight of 338.49 g/mol, XLogP of 3.57, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(5-hydroxy-4,8-dimethylnon-7-enyl)-6-(2-hydroxyethylidene)-2-methyloxepan-3-one is sourced from PubChem (CID 57105352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).